5-methoxy-1H-Pyrrolo[2,3-c]pyridine-2-methanol - Names and Identifiers
Name | (5-methoxy-1H-pyrrolo[2,3-c]pyridin-2-yl)methanol
|
Synonyms | 5-methoxy-1H-Pyrrolo[2,3-c]pyridine-2-methanol 1H-Pyrrolo[2,3-c]pyridine-2-methanol, 5-methoxy- (5-METHOXY-1H-PYRROLO[2,3-C]PYRIDIN-2-YL)METHANOL (5-Methoxy-1H-pyrrolo[2,3-c]pyridin-2-yl)methanol (5-methoxy-1H-pyrrolo[2,3-c]pyridin-2-yl)methanol
|
CAS | 17288-43-6
|
InChI | InChI=1/C9H10N2O2/c1-13-9-3-6-2-7(5-12)11-8(6)4-10-9/h2-4,11-12H,5H2,1H3 |
5-methoxy-1H-Pyrrolo[2,3-c]pyridine-2-methanol - Physico-chemical Properties
Molecular Formula | C9H10N2O2
|
Molar Mass | 178.19 |
Density | 1.340±0.06 g/cm3(Predicted) |
Boling Point | 403.3±40.0 °C(Predicted) |
Flash Point | 197.7°C |
Vapor Presure | 3.14E-07mmHg at 25°C |
pKa | 14.28±0.40(Predicted) |
Storage Condition | Room Temprature |
Sensitive | IRRITANT |
Refractive Index | 1.671 |
MDL | MFCD08448209 |
5-methoxy-1H-Pyrrolo[2,3-c]pyridine-2-methanol - Risk and Safety
Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed.
|
Safety Description | S24/25 - Avoid contact with skin and eyes.
S36/37 - Wear suitable protective clothing and gloves.
|
HS Code | 29339900 |
5-methoxy-1H-Pyrrolo[2,3-c]pyridine-2-methanol - Introduction
5-Methoxy-1-hydro-pyrrole [2,3-c] pyridin-2-ylmethanol is an organic compound with the molecular formula C11H12N2O2. The following are the properties, use, preparation and safety information of the compound:
Nature:
1. Appearance: 5-methoxy-1-hydro-pyrrole [2,3-c] pyridin-2-ylmethanol is a solid substance, usually white or light yellow crystals or powder.
2. Solubility: It is difficult to dissolve in water, but it can be dissolved in common organic solvents, such as methanol and ethanol.
3. Chemical properties: it is a basic compound containing nitrogen and oxygen atoms, which can react with acid. It is also an electrophilic reagent that can undergo electrophilic substitution reactions with electron-rich compounds.
Use:
5-Methoxy -1 Hydrogen-pyrrole [2,3-c] pyridin-2-ylmethanol has a wide range of applications in organic synthesis:
1. It can be used as an important chemical reagent for the synthesis of other organic compounds.
2. It is used as an intermediate for the synthesis of drugs in the pharmaceutical field.
3. It can also be used for the synthesis of pesticides.
Method:
The preparation method of 5-methoxy -1 Hydrogen-pyrrole [2,3-c] pyridin -2-yl methanol is synthesized by chemical reaction, and the specific method depends on the specific conditions and needs. A common method of preparation is the reaction of pyrrole compounds with methanol.
Safety Information:
1. 5-Methoxy -1 Hydrogen-pyrrole [2,3-c] pyridin-2-ylmethanol is stable under general conditions, but at high temperature, decomposition or unpredictable reactions may occur under high pressure or light. Therefore, exposure to these conditions should be avoided during storage and handling.
2. When using chemicals, wear appropriate personal protective equipment, such as gloves, glasses and lab clothes. Care should be taken to avoid contact with skin, eyes and respiratory tract.
3. If you come into contact with the compound, rinse immediately with plenty of water and seek medical help.
4. Please ensure that the compound is stored and used in a suitable laboratory environment, away from flammable substances and oxidizing agents.
Please note that the correct operating methods and laboratory safety regulations should be followed when using chemicals.
Last Update:2024-04-09 20:48:19